EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O6 |
| Net Charge | 0 |
| Average Mass | 361.354 |
| Monoisotopic Mass | 361.12739 |
| SMILES | CON=C(C)c1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OC |
| InChI | InChI=1S/C17H19N3O6/c1-10(20-25-5)11-7-6-8-12(15(11)16(21)24-4)26-17-18-13(22-2)9-14(19-17)23-3/h6-9H,1-5H3 |
| InChIKey | USSIUIGPBLPCDF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyriminobac-methyl (CHEBI:81780) has functional parent pyriminobac (CHEBI:82038) |
| pyriminobac-methyl (CHEBI:81780) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| pyriminobac-methyl (CHEBI:81780) has role herbicide (CHEBI:24527) |
| pyriminobac-methyl (CHEBI:81780) is a aromatic ether (CHEBI:35618) |
| pyriminobac-methyl (CHEBI:81780) is a benzoate ester (CHEBI:36054) |
| pyriminobac-methyl (CHEBI:81780) is a methyl ester (CHEBI:25248) |
| pyriminobac-methyl (CHEBI:81780) is a oxime O-ether (CHEBI:36816) |
| pyriminobac-methyl (CHEBI:81780) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| methyl 2-[(4,6-dimethoxypyrimidin-2-yl)oxy]-6-(N-methoxyethanimidoyl)benzoate |
| Synonyms | Source |
|---|---|
| methyl 2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]-6-[1-(methoxyimino)ethyl]benzoate | ChEBI |
| KUH-920 | PPDB |
| KIH-6127 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| C18486 | KEGG COMPOUND |
| HMDB0040546 | HMDB |
| FDB020316 | FooDB |
| 1581 | PPDB |
| derivatives/pyriminobac-methyl | Alan Wood's Pesticides |
| 16738654 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8396145 | Reaxys |
| CAS:136191-64-5 | ChemIDplus |
| Citations |
|---|