EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3S |
| Net Charge | 0 |
| Average Mass | 223.253 |
| Monoisotopic Mass | 223.03031 |
| SMILES | C=CCOC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H9NO3S/c1-2-7-14-10-8-5-3-4-6-9(8)15(12,13)11-10/h2-6H,1,7H2 |
| InChIKey | WHHIPMZEDGBUCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | plant activator Any compound that protects plants by activating their defence mechanisms. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| probenazole (CHEBI:81778) has functional parent saccharin (CHEBI:32111) |
| probenazole (CHEBI:81778) has role antifungal agrochemical (CHEBI:86328) |
| probenazole (CHEBI:81778) has role plant activator (CHEBI:73182) |
| probenazole (CHEBI:81778) is a 1,2-benzisothiazole (CHEBI:55505) |
| probenazole (CHEBI:81778) is a aromatic ether (CHEBI:35618) |
| probenazole (CHEBI:81778) is a benzothiazole fungicide (CHEBI:87038) |
| probenazole (CHEBI:81778) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 3-(allyloxy)-1,2-benzothiazole 1,1-dioxide |
| Synonyms | Source |
|---|---|
| 3-(2-propen-1-yloxy)-1,2-benzisothiazole 1,1-dioxide | Alan Wood's Pesticides |
| 3-(2-Propenyloxy)-1,2-benzisothiazole 1,1-dioxide | ChemIDplus |
| 3-allyloxy-1,2-benz[d]isothiazole 1,1-dioxide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 2928 | PPDB |
| C18483 | KEGG COMPOUND |
| CN101822265 | Patent |
| CN101828561 | Patent |
| probenazole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1214464 | Reaxys |
| CAS:27605-76-1 | NIST Chemistry WebBook |
| CAS:27605-76-1 | ChemIDplus |
| CAS:27605-76-1 | KEGG COMPOUND |
| Citations |
|---|