EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO4 |
| Net Charge | 0 |
| Average Mass | 291.347 |
| Monoisotopic Mass | 291.14706 |
| SMILES | COc1cc(C(=O)OC2CC3CCC(C2)N3C)ccc1O |
| InChI | InChI=1S/C16H21NO4/c1-17-11-4-5-12(17)9-13(8-11)21-16(19)10-3-6-14(18)15(7-10)20-2/h3,6-7,11-13,18H,4-5,8-9H2,1-2H3 |
| InChIKey | OZKTVDIYALBSMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phyllalbine (CHEBI:8176) is a methoxybenzoic acid (CHEBI:25238) |
| Synonym | Source |
|---|---|
| Phyllalbine | KEGG COMPOUND |