EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4NS2.Na |
| Net Charge | 0 |
| Average Mass | 129.185 |
| Monoisotopic Mass | 128.96829 |
| SMILES | CNC(=S)[S-].[Na+] |
| InChI | InChI=1S/C2H5NS2.Na/c1-3-2(4)5;/h1H3,(H2,3,4,5);/q;+1/p-1 |
| InChIKey | AFCCDDWKHLHPDF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. |
| Applications: | pronematicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active nematicide for which it is a pronematicide. profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metam-sodium (CHEBI:81737) has part metam(1−) (CHEBI:141326) |
| metam-sodium (CHEBI:81737) has role profungicide (CHEBI:136645) |
| metam-sodium (CHEBI:81737) has role proherbicide (CHEBI:136646) |
| metam-sodium (CHEBI:81737) has role proinsecticide (CHEBI:136644) |
| metam-sodium (CHEBI:81737) has role pronematicide (CHEBI:141301) |
| metam-sodium (CHEBI:81737) is a organic sodium salt (CHEBI:38700) |
| metam-sodium (CHEBI:81737) is a organosulfur insecticide (CHEBI:39190) |
| IUPAC Name |
|---|
| sodium methylcarbamodithioate |
| Synonyms | Source |
|---|---|
| Carbam | KEGG COMPOUND |
| carbam-sodium | Alan Wood's Pesticides |
| carbathion | Alan Wood's Pesticides |
| metam | ChEBI |
| métam-sodium | ChEBI |
| metham | ChEBI |
| Brand Names | Source |
|---|---|
| Sectagon | ChEBI |
| Vapam | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 447 | PPDB |
| C18424 | KEGG COMPOUND |
| derivatives/metam-sodium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1071426 | Reaxys |
| CAS:137-42-8 | Alan Wood's Pesticides |
| CAS:137-42-8 | KEGG COMPOUND |
| CAS:137-42-8 | ChemIDplus |
| Citations |
|---|