EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O2S |
| Net Charge | 0 |
| Average Mass | 330.453 |
| Monoisotopic Mass | 330.14020 |
| SMILES | COc1cccc(N(C)C(=S)Oc2cccc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C18H22N2O2S/c1-18(2,3)13-8-6-9-14(12-13)22-17(23)20(4)15-10-7-11-16(19-15)21-5/h6-12H,1-5H3 |
| InChIKey | VTRWMTJQBQJKQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyributicarb (CHEBI:81736) has role antifungal agrochemical (CHEBI:86328) |
| pyributicarb (CHEBI:81736) has role herbicide (CHEBI:24527) |
| pyributicarb (CHEBI:81736) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| pyributicarb (CHEBI:81736) is a aromatic ether (CHEBI:35618) |
| pyributicarb (CHEBI:81736) is a monothiocarbamic ester (CHEBI:38128) |
| pyributicarb (CHEBI:81736) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| O-(3-tert-butylphenyl) (6-methoxypyridin-2-yl)methylcarbamothioate |
| Synonyms | Source |
|---|---|
| O-[3-(1,1-dimethylethyl)phenyl] N-(6-methoxy-2-pyridinyl)-N-methylcarbamothioate | Alan Wood's Pesticides |
| O-3-tert-butylphenyl 6-methoxy-2-pyridyl(methyl)thiocarbamate | Alan Wood's Pesticides |
| pyributicarbe | ChEBI |
| TSH-888 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18422 | KEGG COMPOUND |
| pyributicarb | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343509 | Reaxys |
| CAS:88678-67-5 | KEGG COMPOUND |
| Citations |
|---|