EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24FN3O3S |
| Net Charge | 0 |
| Average Mass | 381.473 |
| Monoisotopic Mass | 381.15224 |
| SMILES | CC(C)OC(=O)N[C@H](C(=O)N[C@H](C)c1nc2ccc(F)cc2s1)C(C)C |
| InChI | InChI=1S/C18H24FN3O3S/c1-9(2)15(22-18(24)25-10(3)4)16(23)20-11(5)17-21-13-7-6-12(19)8-14(13)26-17/h6-11,15H,1-5H3,(H,20,23)(H,22,24)/t11-,15+/m1/s1 |
| InChIKey | USRKFGIXLGKMKU-ABAIWWIYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benthiavalicarb-isopropyl (CHEBI:81732) has functional parent benthiavalicarb (CHEBI:83601) |
| benthiavalicarb-isopropyl (CHEBI:81732) has role antifungal agrochemical (CHEBI:86328) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a benzothiazole fungicide (CHEBI:87038) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a benzothiazoles (CHEBI:37947) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a carbamate ester (CHEBI:23003) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a carbamate fungicide (CHEBI:87061) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a organofluorine compound (CHEBI:37143) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a secondary carboxamide (CHEBI:140325) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a valinamide fungicide (CHEBI:87029) |
| benthiavalicarb-isopropyl (CHEBI:81732) is a valine derivative (CHEBI:27267) |
| IUPAC Name |
|---|
| isopropyl [(2S)-1-{[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino}-3-methyl-1-oxobutan-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| 1-methylethyl ((1S)-1-((((1R)-1-(6-fluoro-2-benzothiazolyl)ethyl)amino)carbonyl)-2-methylpropyl)carbamate | ChemIDplus |
| benthiavalicarb isopropyl | ChemIDplus |
| isopropyl ((S)-1-{((1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl)carbamoyl}-2-methylpropyl)carbamate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2172 | PPDB |
| C18415 | KEGG COMPOUND |
| derivatives/benthiavalicarb-isopropyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343403 | Reaxys |
| CAS:177406-68-7 | KEGG COMPOUND |
| CAS:177406-68-7 | ChemIDplus |
| Citations |
|---|