EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24O11 |
| Net Charge | 0 |
| Average Mass | 488.445 |
| Monoisotopic Mass | 488.13186 |
| SMILES | [H][C@]12CO[C@@H](Oc3cc4c(cc3OC)OCO4)[C@@]1(OC(C)=O)CO[C@@H]2c1cc2c(cc1OC)OCO2 |
| InChI | InChI=1S/C24H24O11/c1-12(25)35-24-9-29-22(13-4-17-18(31-10-30-17)5-15(13)26-2)14(24)8-28-23(24)34-21-7-20-19(32-11-33-20)6-16(21)27-3/h4-7,14,22-23H,8-11H2,1-3H3/t14-,22-,23+,24-/m1/s1 |
| InChIKey | ZGBQEJGNORPNKC-PDLWQGAHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phrymarolin I (CHEBI:8173) is a benzodioxoles (CHEBI:38298) |
| Phrymarolin I (CHEBI:8173) is conjugate base of quinapril(1+) (CHEBI:141523) |
| Incoming Relation(s) |
| quinapril(1+) (CHEBI:141523) is conjugate acid of Phrymarolin I (CHEBI:8173) |
| Synonym | Source |
|---|---|
| Phrymarolin I | KEGG COMPOUND |