EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C3H5O2.Mg |
| Net Charge | 0 |
| Average Mass | 170.447 |
| Monoisotopic Mass | 170.04295 |
| SMILES | CCC(=O)[O-].CCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C3H6O2.Mg/c2*1-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2 |
| InChIKey | CQQJGTPWCKCEOQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium dipropionate (CHEBI:81721) is a organic magnesium salt (CHEBI:190299) |
| IUPAC Name |
|---|
| magnesium dipropanoate |
| Synonyms | Source |
|---|---|
| magnesium propanoate | ChEBI |
| magnesium propionate | ChemIDplus |
| opionic acid magnesium salt | ChEBI |
| propanoic acid magnesium salt | ChEBI |
| propanoic acid, magnesium salt | ChEBI |
| propionic acid, magnesium salt | ChEBI |
| Citations |
|---|