EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O4S |
| Net Charge | 0 |
| Average Mass | 230.245 |
| Monoisotopic Mass | 230.03613 |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H10N2O4S/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | VGPYEHKOIGNJKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asulam (CHEBI:81696) has role agrochemical (CHEBI:33286) |
| asulam (CHEBI:81696) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| asulam (CHEBI:81696) has role environmental contaminant (CHEBI:78298) |
| asulam (CHEBI:81696) has role herbicide (CHEBI:24527) |
| asulam (CHEBI:81696) has role xenobiotic (CHEBI:35703) |
| asulam (CHEBI:81696) is a carbamate ester (CHEBI:23003) |
| asulam (CHEBI:81696) is a primary amino compound (CHEBI:50994) |
| asulam (CHEBI:81696) is a substituted aniline (CHEBI:48975) |
| asulam (CHEBI:81696) is a sulfonamide (CHEBI:35358) |
| asulam (CHEBI:81696) is conjugate acid of asulam(1−) (CHEBI:142669) |
| Incoming Relation(s) |
| asulam(1−) (CHEBI:142669) is conjugate base of asulam (CHEBI:81696) |
| IUPAC Name |
|---|
| methyl [(4-aminophenyl)sulfonyl]carbamate |
| Synonyms | Source |
|---|---|
| methyl sulfanilylcarbamate | ChemIDplus |
| methyl N-(4-aminobenzenesulfonyl)carbamate | ChemIDplus |
| asulame | ChemIDplus |
| N1-methoxycarbonylsulfanilamide | ChemIDplus |
| 4-Amino-benzolsulfonyl-methylcarbamat | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18350 | KEGG COMPOUND |
| Asulam | Wikipedia |
| asulam | Alan Wood's Pesticides |
| CN101704771 | Patent |
| CN101492401 | Patent |
| 1551 | PPDB |
| BE622214 | Patent |
| Citations |
|---|