EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O10 |
| Net Charge | 0 |
| Average Mass | 352.251 |
| Monoisotopic Mass | 352.04305 |
| SMILES | COc1cc(C(=O)O)cc(C(=O)/C=C(\C=C(\O)C(=O)O)C(=O)O)c1O |
| InChI | InChI=1S/C15H12O10/c1-25-11-5-6(13(19)20)2-8(12(11)18)9(16)3-7(14(21)22)4-10(17)15(23)24/h2-5,17-18H,1H3,(H,19,20)(H,21,22)(H,23,24)/b7-3+,10-4+ |
| InChIKey | VZGTUGLDTXOTPI-DROBUMMNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[2-(5-Carboxy-2-hydroxy-3-methoxyphenyl)-2-oxoethylidene]-2-hydroxy-2-pentenedioate (CHEBI:81695) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| C18349 | KEGG COMPOUND |