EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O8 |
| Net Charge | 0 |
| Average Mass | 334.280 |
| Monoisotopic Mass | 334.06887 |
| SMILES | COc1cc(C(=O)O)cc(-c2cc(C(=O)O)cc(OC)c2O)c1O |
| InChI | InChI=1S/C16H14O8/c1-23-11-5-7(15(19)20)3-9(13(11)17)10-4-8(16(21)22)6-12(24-2)14(10)18/h3-6,17-18H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QGCWGSXMGCSFDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5'-Dehydrodivanillate (CHEBI:81693) is a biphenyls (CHEBI:22888) |
| 5,5'-Dehydrodivanillate (CHEBI:81693) is a carboxybiphenyl (CHEBI:141493) |
| 5,5'-Dehydrodivanillate (CHEBI:81693) is conjugate acid of 5,5'-dehydrodivanillate(2−) (CHEBI:141401) |
| Incoming Relation(s) |
| 5,5'-dehydrodivanillate(2−) (CHEBI:141401) is conjugate base of 5,5'-Dehydrodivanillate (CHEBI:81693) |
| Manual Xrefs | Databases |
|---|---|
| C18347 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2134-90-9 | KEGG COMPOUND |