EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O6 |
| Net Charge | 0 |
| Average Mass | 212.157 |
| Monoisotopic Mass | 212.03209 |
| SMILES | COc1cc(C(=O)O)cc(C(=O)O)c1O |
| InChI | InChI=1S/C9H8O6/c1-15-6-3-4(8(11)12)2-5(7(6)10)9(13)14/h2-3,10H,1H3,(H,11,12)(H,13,14) |
| InChIKey | NLSSJYQPZIQJNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Carboxyvanillic acid (CHEBI:81684) is a 2-hydroxyisophthalic acid (CHEBI:19643) |
| Incoming Relation(s) |
| 5-carboxyvanillate (CHEBI:747443) is conjugate base of 5-Carboxyvanillic acid (CHEBI:81684) |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-5-methoxy-1,3-benzenedicarboxylate | KEGG COMPOUND |
| 4-Hydroxy-5-methoxyisophthalate | KEGG COMPOUND |
| 5-Carboxyvanillate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18338 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2134-91-0 | KEGG COMPOUND |