EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O3 |
| Net Charge | 0 |
| Average Mass | 138.122 |
| Monoisotopic Mass | 138.03169 |
| SMILES | CC1=CC(=O)C(O)=CC1=O |
| InChI | InChI=1S/C7H6O3/c1-4-2-6(9)7(10)3-5(4)8/h2-3,10H,1H3 |
| InChIKey | BMBZVGUSOUAIMK-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-5-methylquinone (CHEBI:81667) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| 2-hydroxy-5-methylquinone (CHEBI:81667) is conjugate acid of 2-oxido-5-methylquinone (CHEBI:88190) |
| Incoming Relation(s) |
| 2,3-dihydroxy-5-methyl-1,4-benzoquinone (CHEBI:46691) has functional parent 2-hydroxy-5-methylquinone (CHEBI:81667) |
| 2-oxido-5-methylquinone (CHEBI:88190) is conjugate base of 2-hydroxy-5-methylquinone (CHEBI:81667) |
| IUPAC Name |
|---|
| 2-hydroxy-5-methylcyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-5-methyl-1,4-benzoquinone | KEGG COMPOUND |
| 2-Hydroxy-5-methyl-p-benzoquinone | ChemIDplus |