EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | Cc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO4/c1-4-2-6(9)7(10)3-5(4)8(11)12/h2-3,9-10H,1H3 |
| InChIKey | WLLRAKCRHPMKNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (8195105) | Strain: DNT |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-5-nitrocatechol (CHEBI:81666) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4-methyl-5-nitrocatechol (CHEBI:81666) is a catechols (CHEBI:33566) |
| 4-methyl-5-nitrocatechol (CHEBI:81666) is a nitrotoluene (CHEBI:25566) |
| IUPAC Name |
|---|
| 4-methyl-5-nitrobenzene-1,2-diol |
| Synonym | Source |
|---|---|
| 4M5NC | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methyl-5-nitrocatechol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3257244 | Reaxys |
| CAS:68906-21-8 | KEGG COMPOUND |
| CAS:68906-21-8 | ChemIDplus |
| Citations |
|---|