EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | CC(C(=O)O)C(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H8O5/c1-4(7(11)12)5(8)2-3-6(9)10/h2-4H,1H3,(H,9,10)(H,11,12)/b3-2- |
| InChIKey | MMXCAAVDMQKUFL-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methylmaleylacetate (CHEBI:81657) is a oxo carboxylic acid (CHEBI:25754) |
| Manual Xrefs | Databases |
|---|---|
| C18306 | KEGG COMPOUND |