EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6Cl2O4 |
| Net Charge | 0 |
| Average Mass | 225.027 |
| Monoisotopic Mass | 223.96431 |
| SMILES | C/C(C(=O)O)=C(Cl)/C=C(/Cl)C(=O)O |
| InChI | InChI=1S/C7H6Cl2O4/c1-3(6(10)11)4(8)2-5(9)7(12)13/h2H,1H3,(H,10,11)(H,12,13)/b4-3+,5-2+ |
| InChIKey | NWPNKOYCKBKKCL-JWVZGZSZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-Dichloro-2-methylmuconate (CHEBI:81654) is a halo fatty acid (CHEBI:60692) |
| Manual Xrefs | Databases |
|---|---|
| C18303 | KEGG COMPOUND |