EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21ClN2O7 |
| Net Charge | 0 |
| Average Mass | 460.870 |
| Monoisotopic Mass | 460.10373 |
| SMILES | [H][C@@]12Cc3c(c(O)c4c(O)ccc(Cl)c4c3C)C(=O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C |
| InChI | InChI=1S/C22H21ClN2O7/c1-7-8-6-9-16(25(2)3)18(28)15(21(24)31)20(30)22(9,32)19(29)13(8)17(27)14-11(26)5-4-10(23)12(7)14/h4-5,9,16,26-28,32H,6H2,1-3H3,(H2,24,31)/t9-,16-,22-/m0/s1 |
| InChIKey | NICZYMKKWKYGHT-BAQLRCJTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anhydrochlortetracycline (CHEBI:81648) is a tetracyclines (CHEBI:26895) |
| Synonym | Source |
|---|---|
| Anhydro-7-chlorotetracycline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18297 | KEGG COMPOUND |