EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O |
| Net Charge | 0 |
| Average Mass | 268.315 |
| Monoisotopic Mass | 268.08882 |
| SMILES | c1ccc2c3c4c(ccc5cccc(c54)C4OC34)cc2c1 |
| InChI | InChI=1S/C20H12O/c1-2-6-14-12(4-1)10-13-9-8-11-5-3-7-15-16(11)17(13)18(14)20-19(15)21-20/h1-10,19-20H |
| InChIKey | ISBWKKKMLFVMHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzo[a]pyrene-11,12-epoxide (CHEBI:81637) is a phenanthrenes (CHEBI:25961) |
| Manual Xrefs | Databases |
|---|---|
| C18286 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:60448-19-3 | KEGG COMPOUND |