EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O2 |
| Net Charge | 0 |
| Average Mass | 286.330 |
| Monoisotopic Mass | 286.09938 |
| SMILES | O[C@@H]1c2cccc3ccc4cc5ccccc5c(c4c23)[C@@H]1O |
| InChI | InChI=1S/C20H14O2/c21-19-15-7-3-5-11-8-9-13-10-12-4-1-2-6-14(12)18(20(19)22)17(13)16(11)15/h1-10,19-22H/t19-,20+/m1/s1 |
| InChIKey | SGHZUKBSLLOHPU-UXHICEINSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzo[a]pyrene-cis-11,12-dihydrodiol (CHEBI:81635) is a phenanthrol (CHEBI:25962) |
| Manual Xrefs | Databases |
|---|---|
| C18284 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:64283-13-2 | KEGG COMPOUND |