EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O2 |
| Net Charge | 0 |
| Average Mass | 284.314 |
| Monoisotopic Mass | 284.08373 |
| SMILES | Oc1c(O)c2c3ccccc3cc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C20H12O2/c21-19-15-7-3-5-11-8-9-13-10-12-4-1-2-6-14(12)18(20(19)22)17(13)16(11)15/h1-10,21-22H |
| InChIKey | PDJGMYRLJBMBHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-Dihydroxybenzo[a]pyrene (CHEBI:81631) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Synonym | Source |
|---|---|
| Benzo[a]pyrene-11,12-diol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18280 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:65277-41-0 | KEGG COMPOUND |