EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O2 |
| Net Charge | 0 |
| Average Mass | 248.281 |
| Monoisotopic Mass | 248.08373 |
| SMILES | O=C(O)C1CC=c2ccc3cccc4ccc1c2c43 |
| InChI | InChI=1S/C17H12O2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-8,14H,9H2,(H,18,19) |
| InChIKey | KJCULGPSFZKSBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-Dihydropyrene-8-carboxylate (CHEBI:81624) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| 1,2-Dihydropyrene-1-carboxylate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18273 | KEGG COMPOUND |