EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | O=C(O)[C@]1(O)c2c(ccc3ccccc23)C=C[C@H]1O |
| InChI | InChI=1S/C15H12O4/c16-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15(12,19)14(17)18/h1-8,12,16,19H,(H,17,18)/t12-,15-/m1/s1 |
| InChIKey | WBAZPUVNIAXCFM-IUODEOHRSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3,4-Phenanthrenedihydrodiol-4-carboxylate (CHEBI:81607) is a phenanthrol (CHEBI:25962) |
| Manual Xrefs | Databases |
|---|---|
| C18256 | KEGG COMPOUND |