EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O2 |
| Net Charge | 0 |
| Average Mass | 222.243 |
| Monoisotopic Mass | 222.06808 |
| SMILES | O=C(O)c1cccc2ccc3ccccc3c12 |
| InChI | InChI=1S/C15H10O2/c16-15(17)13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9H,(H,16,17) |
| InChIKey | HHZVGTSZLAQRSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenanthrene-4-carboxylate (CHEBI:81604) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| 4-Phenanthroic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18253 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:42156-92-3 | KEGG COMPOUND |