EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6Br4O |
| Net Charge | 0 |
| Average Mass | 485.795 |
| Monoisotopic Mass | 481.71521 |
| SMILES | Brc1ccc(Oc2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C12H6Br4O/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6H |
| InChIKey | XYBSIYMGXVUVGY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | Article (Report on Human Biomonitoring of Environmental Chemicals in Canada (2010). ISBN 978-1-100-15618-7. Cat no. H128-1/10-601E) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',4,4'-Tetrabromodiphenyl ether (CHEBI:81584) is a aromatic ether (CHEBI:35618) |
| 2,2',4,4'-Tetrabromodiphenyl ether (CHEBI:81584) is a organobromine compound (CHEBI:37141) |
| Synonyms | Source |
|---|---|
| 1,1'-Oxybis(2,4-dibromobenzene) | HMDB |
| 1,1'-Oxybis(2,4-dibromo-Benzene | HMDB |
| 1,1'-Oxybis[2,4-dibromobenzene], 9CI | HMDB |
| 2,2',4,4'-TetraBDE | HMDB |
| 2,2',4,4'-Tetrabromodiphenyl ether | HMDB |
| 2,2'4,4'-Tetrabromodiphenyl ether | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18205 | KEGG COMPOUND |
| HMDB0037547 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:5436-43-1 | KEGG COMPOUND |
| Citations |
|---|