EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-21,23-25H,2,13,15-16,18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,11-8-,14-10+,17-12+/t19-,20+,21-/m1/s1 |
| InChIKey | IKFAUGXNBOBQDM-XFMPMKITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (22844113) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (23723388) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | estrogen receptor agonist An agonist at the estrogen receptor. anti-obesity agent Any substance which is used to reduce or control weight. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D2 (CHEBI:81565) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D2 (CHEBI:81565) has role anti-obesity agent (CHEBI:74518) |
| resolvin D2 (CHEBI:81565) has role estrogen receptor agonist (CHEBI:63951) |
| resolvin D2 (CHEBI:81565) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin D2 (CHEBI:81565) has role rat metabolite (CHEBI:86264) |
| resolvin D2 (CHEBI:81565) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D2 (CHEBI:81565) is a resolvin (CHEBI:132120) |
| resolvin D2 (CHEBI:81565) is a secondary allylic alcohol (CHEBI:134396) |
| resolvin D2 (CHEBI:81565) is a triol (CHEBI:27136) |
| resolvin D2 (CHEBI:81565) is conjugate acid of resolvin D2(1−) (CHEBI:133367) |
| Incoming Relation(s) |
| resolvin D2(1−) (CHEBI:133367) is conjugate base of resolvin D2 (CHEBI:81565) |
| IUPAC Name |
|---|
| (4Z,7R,8E,10Z,12E,14E,16R,17S,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 7S,16R,17S-trihydroxy-4Z,8E,10Z,12E,14E,19Z-docosahexaenoic acid | LIPID MAPS |
| RVD2 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18179 | KEGG COMPOUND |
| CPD66-65 | MetaCyc |
| HMDB0002294 | HMDB |
| LMFA04000007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9876619 | Reaxys |
| CAS:82864-77-5 | HMDB |
| Citations |
|---|