EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81565 - resolvin D2
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-21,23-25H,2,13,15-16,18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,11-8-,14-10+,17-12+/t19-,20+,21-/m1/s1 |
| InChIKey | IKFAUGXNBOBQDM-XFMPMKITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (22844113) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (23723388) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). anti-obesity agent Any substance which is used to reduce or control weight. estrogen receptor agonist An agonist at the estrogen receptor. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D2 (CHEBI:81565) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D2 (CHEBI:81565) has role anti-obesity agent (CHEBI:74518) |
| resolvin D2 (CHEBI:81565) has role estrogen receptor agonist (CHEBI:63951) |
| resolvin D2 (CHEBI:81565) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin D2 (CHEBI:81565) has role rat metabolite (CHEBI:86264) |
| resolvin D2 (CHEBI:81565) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D2 (CHEBI:81565) is a resolvin (CHEBI:132120) |
| resolvin D2 (CHEBI:81565) is a secondary allylic alcohol (CHEBI:134396) |
| resolvin D2 (CHEBI:81565) is a triol (CHEBI:27136) |
| resolvin D2 (CHEBI:81565) is conjugate acid of resolvin D2(1−) (CHEBI:133367) |
| Incoming Relation(s) |
| resolvin D2(1−) (CHEBI:133367) is conjugate base of resolvin D2 (CHEBI:81565) |
| IUPAC Name |
|---|
| (4Z,7R,8E,10Z,12E,14E,16R,17S,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 7S,16R,17S-trihydroxy-4Z,8E,10Z,12E,14E,19Z-docosahexaenoic acid | LIPID MAPS |
| RVD2 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18179 | KEGG COMPOUND |
| CPD66-65 | MetaCyc |
| HMDB0002294 | HMDB |
| LMFA04000007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9876619 | Reaxys |
| CAS:82864-77-5 | HMDB |
| Citations |
|---|