EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC[C@@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](CCCC(=O)O)OO |
| InChI | InChI=1S/C20H30O5/c1-2-18(21)14-11-9-7-5-3-4-6-8-10-12-15-19(25-24)16-13-17-20(22)23/h3-4,7-12,14-15,18-19,21,24H,2,5-6,13,16-17H2,1H3,(H,22,23)/b4-3-,9-7-,10-8-,14-11+,15-12+/t18-,19-/m1/s1 |
| InChIKey | JIOJPWROWDJRKM-NNQKPOSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5S-Hydroperoxy-18R-HEPE (CHEBI:81562) is a HPETE (CHEBI:24644) |
| Synonym | Source |
|---|---|
| 5S-Hydroperoxy-18R-hydroxy-6E,8Z,11Z,14Z,16E-eicosapentaenoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18176 | KEGG COMPOUND |