EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81548 - 3-vinylbacteriochlorophyllide d
| Formula | C33H32MgN4O3 |
| Net Charge | 0 |
| Average Mass | 556.949 |
| Monoisotopic Mass | 556.23248 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(C)c6c7[n]5[Mg-2]34[N+]3=C(C=2)[C@@H](C)[C@H](CCC(=O)O)C3=C7CC6=O)C(CC)=C1C |
| InChI | InChI=1S/C33H34N4O3.Mg/c1-7-19-15(3)23-12-25-17(5)21(9-10-30(39)40)32(36-25)22-11-29(38)31-18(6)26(37-33(22)31)14-28-20(8-2)16(4)24(35-28)13-27(19)34-23;/h7,12-14,17,21H,1,8-11H2,2-6H3,(H3,34,35,36,37,38,39,40);/q;+2/p-2/t17-,21-;/m0./s1 |
| InChIKey | BJEMYNDCFDVJRP-PVMVIUQGSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorobaculum tepidum (ncbitaxon:1097) | - | PubMed (17586634) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-vinylbacteriochlorophyllide d (CHEBI:81548) has role bacterial metabolite (CHEBI:76969) |
| 3-vinylbacteriochlorophyllide d (CHEBI:81548) is a chlorophyllide (CHEBI:38206) |
| 3-vinylbacteriochlorophyllide d (CHEBI:81548) is a monocarboxylic acid (CHEBI:25384) |
| 3-vinylbacteriochlorophyllide d (CHEBI:81548) is conjugate acid of 3-vinylbacteriochlorophyllide d(1−) (CHEBI:90963) |
| Incoming Relation(s) |
| 3-vinylbacteriochlorophyllide d(1−) (CHEBI:90963) is conjugate base of 3-vinylbacteriochlorophyllide d (CHEBI:81548) |
| IUPAC Name |
|---|
| {3-[(3S,4S)-9-ethenyl-14-ethyl-4,8,13,18-tetramethyl-20-oxophorbin-3-yl-κ4N23,N24,N25,N26]propanoato(2−)}magnesium |
| Synonym | Source |
|---|---|
| 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d | MetaCyc |
| Citations |
|---|