EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H5Cl9 |
| Net Charge | 0 |
| Average Mass | 444.227 |
| Monoisotopic Mass | 439.75880 |
| SMILES | [H][C@]12[C@H](Cl)C(Cl)[C@H](Cl)[C@@]1([H])[C@@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H5Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-5H/t1-,2+,3+,4-,5?,8+,9- |
| InChIKey | OCHOKXCPKDPNQU-FLVMBEMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | Article (Report on Human Biomonitoring of Environmental Chemicals in Canada (2010). ISBN 978-1-100-15618-7. Cat no. H128-1/10-601E) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-Nonachlor (CHEBI:81540) is a organochlorine compound (CHEBI:36683) |
| Synonym | Source |
|---|---|
| (1R,2S,3R,4R,5S,6R,7S)-1,3,4,5,7,8,9,10,10-nonachlorotricyclo[5.2.1.0²,⁶]dec-8-ene | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18145 | KEGG COMPOUND |
| HMDB0059570 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:39765-80-5 | KEGG COMPOUND |
| Citations |
|---|