EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8Cl6O |
| Net Charge | 0 |
| Average Mass | 380.913 |
| Monoisotopic Mass | 377.87063 |
| SMILES | [H][C@]12C[C@]([H])([C@]3([H])O[C@]13[H])[C@@]1([H])[C@]2([H])[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2/t2-,3+,4-,5+,6-,7+,10-,11+ |
| InChIKey | DFBKLUNHFCTMDC-GKRDHZSOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neurotoxin A poison that interferes with the functions of the nervous system. |
| Applications: | avicide A substance used to destroy bird pests (class Aves). rodenticide A substance used to destroy rodent pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endrin (CHEBI:81526) has functional parent Isodrin (CHEBI:82100) |
| endrin (CHEBI:81526) has role avicide (CHEBI:33289) |
| endrin (CHEBI:81526) has role neurotoxin (CHEBI:50910) |
| endrin (CHEBI:81526) has role persistent organic pollutant (CHEBI:77853) |
| endrin (CHEBI:81526) has role rodenticide (CHEBI:33288) |
| endrin (CHEBI:81526) has role xenobiotic (CHEBI:35703) |
| endrin (CHEBI:81526) is a epoxide (CHEBI:32955) |
| endrin (CHEBI:81526) is a organochlorine insecticide (CHEBI:25705) |
| IUPAC Name |
|---|
| rel-(1aR,2R,2aR,3R,6S,6aS,7S,7aS)-3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-2,7:3,6-dimethanonaphtho[2,3-b]oxirene |
| Synonyms | Source |
|---|---|
| 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-endo,endo-1,4:5,8-dimethanonaphthalene | ChemIDplus |
| 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-exo-1,4-exo-5,8-dimethanonaphthalene | Alan Wood's Pesticides |
| (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-2,7:3,6-dimethanonaphtho[2,3-b]oxirene | ChEBI |
| (1aR,2R,2aR,3R,6S,6aS,7S,7aS)-rel-3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-2,7:3,6-dimethanonaphth[2,3-b]oxirene | Alan Wood's Pesticides |
| (1R,2S,3R,6S,7R,8S,9S,11R)-3,4,5,6,13,13-Hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-ene | IUPAC |
| (1R,4S,4aS,5S,6S,7R,8R,8aR)-1,2,3,4,10,10-hexachloro-1,4,4a,5,6,7,8,8a-octahydro-6,7-epoxy-1,4:5,8-dimethanonaphthalene | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| EN 57 | ChemIDplus |
| Endrex | ChemIDplus |
| Endricol | ChemIDplus |
| Hexacrin | ChEBI |
| Hexadrin | ChemIDplus |
| Mendrin | ChemIDplus |
| Citations |
|---|