EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H2Cl6O |
| Net Charge | 0 |
| Average Mass | 374.865 |
| Monoisotopic Mass | 371.82368 |
| SMILES | Clc1cc2c(oc3cc(Cl)c(Cl)c(Cl)c32)c(Cl)c1Cl |
| InChI | InChI=1S/C12H2Cl6O/c13-4-1-3-7-6(2-5(14)8(15)10(7)17)19-12(3)11(18)9(4)16/h1-2H |
| InChIKey | JEYJJJXOFWNEHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,6,7,8-Hexachlorodibenzofuran (CHEBI:81511) is a polychlorinated dibenzofuran (CHEBI:134046) |
| Synonyms | Source |
|---|---|
| 1,2,3,6,7,8-HxCDF | KEGG COMPOUND |
| PCDF 121 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18109 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:57117-44-9 | KEGG COMPOUND |