EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13I3N2O2 |
| Net Charge | 0 |
| Average Mass | 597.960 |
| Monoisotopic Mass | 597.81112 |
| SMILES | CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I |
| InChI | InChI=1S/C12H13I3N2O2/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19/h5-6H,3-4H2,1-2H3,(H,18,19)/b16-6+ |
| InChIKey | YQNFBOJPTAXAKV-OMCISZLKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iopodic acid (CHEBI:81496) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| bilimin acid | DrugCentral |
| bilopten | DrugCentral |
| calcium iopodate | DrugCentral |
| ipodate | DrugCentral |
| ipodate calcium | DrugCentral |
| ipodate sodium | DrugCentral |