EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81485 - osthenol
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | CC(C)=CCc1c(O)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3 |
| InChIKey | RAKJVIPCCGXHHS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica dahurica (ncbitaxon:48101) | root (BTO:0001188) | PubMed (28822155) | |
| Angelica dahurica var. formosana (ncbitaxon:714446) | root (BTO:0001188) | PubMed (26552172) | |
| Cnidium monnieri (ncbitaxon:94007) | fruit (BTO:0000486) | PubMed (26983206) | |
| Pastinaca sativa (ncbitaxon:4041) | root (BTO:0001188) | PubMed (26918393) | |
| Petroselinum crispum (ncbitaxon:4043) | - | PubMed (24354545) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osthenol (CHEBI:81485) has functional parent umbelliferone (CHEBI:27510) |
| osthenol (CHEBI:81485) has role antifungal agent (CHEBI:35718) |
| osthenol (CHEBI:81485) has role plant metabolite (CHEBI:76924) |
| osthenol (CHEBI:81485) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 7-hydroxy--2H-1-benzopyran-2-one |
| Synonyms | Source |
|---|---|
| 7-hydroxy-8-(3-methyl-but-2-enyl)coumarin | ChEBI |
| 7-hydroxy-8-prenylcoumarin | ChEBI |
| 8-(3-methylbut-2-en-1-yl)umbelliferone | ChEBI |
| 8-prenylumbelliferone | ChEBI |
| UniProt Name | Source |
|---|---|
| osthenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00030900 | KNApSAcK |
| C18080 | KEGG COMPOUND |
| CN101362768 | Patent |
| CPD-9838 | MetaCyc |
| HMDB0034130 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:190526 | Reaxys |
| CAS:484-14-0 | ChemIDplus |
| CAS:484-14-0 | KEGG COMPOUND |
| Citations |
|---|