EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O4 |
| Net Charge | 0 |
| Average Mass | 192.170 |
| Monoisotopic Mass | 192.04226 |
| SMILES | COc1cc2oc(=O)ccc2cc1O |
| InChI | InChI=1S/C10H8O4/c1-13-9-5-8-6(4-7(9)11)2-3-10(12)14-8/h2-5,11H,1H3 |
| InChIKey | SYTYLPHCLSSCOJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anacyclus pyrethrum (ncbitaxon:159698) | Root (BTO:0001188) | PubMed (29243430) | |
| Artemisia argyi (ncbitaxon:259893) | leaf (BTO:0000713) | PubMed (16881019) | |
| Citrus medica var. sarcodactylis (ncbitaxon:381790) | fruit (BTO:0000486) | PubMed (34250362) | |
| Dimocarpus longan (ncbitaxon:128017) | - | PubMed (30754614) | |
| Dryopteris fragrans (ncbitaxon:239565) | - | PubMed (24647035) | |
| Fraxinus chinensis (ncbitaxon:56033) | bark (BTO:0001301) | PubMed (33327368) | Isolated from the stem bark. |
| Helianthus tuberosus (ncbitaxon:4233) | - | PubMed (32674454) | |
| Lycium intricatum (ncbitaxon:343886) | - | PubMed (32705905) | |
| Zanthoxylum zanthoxyloides (ncbitaxon:2099548) | - | PubMed (28117749) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoscopoletin (CHEBI:81484) has functional parent esculetin (CHEBI:490095) |
| isoscopoletin (CHEBI:81484) has role plant metabolite (CHEBI:76924) |
| isoscopoletin (CHEBI:81484) is a aromatic ether (CHEBI:35618) |
| isoscopoletin (CHEBI:81484) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 6-hydroxy-7-methoxy-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 6-hydroxy-7-methoxy-2-benzopyrone | ChemIDplus |
| 6-hydroxy-7-methoxy-2H-1-benzopyran-2-one | IUPAC |
| 6-hydroxy-7-methoxychromen-2-one | MetaCyc |
| 6-hydroxy-7-methoxycoumarin | ChemIDplus |
| 6-hydroxyherniarin | ChEBI |
| 7-methoxyesculetin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| isoscopoletin | UniProt |
| Citations |
|---|