EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-15,17,20-21H,3-9H2,1-2H3/t12-,13-,14-,15+,17-,18-,19-/m0/s1 |
| InChIKey | OLPSAOWBSPXZEA-JIEICEMKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (28948822) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (14977864) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has role anti-inflammatory agent (CHEBI:67079) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has role antioxidant (CHEBI:22586) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has role estrogen (CHEBI:50114) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has role human xenobiotic metabolite (CHEBI:76967) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) has role rat metabolite (CHEBI:86264) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) is a 17-oxo steroid (CHEBI:19168) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) is a 7α-hydroxy steroid (CHEBI:36843) |
| 7α-hydroxydehydroepiandrosterone (CHEBI:81471) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β,7α-dihydroxyandrost-5-en-17-one |
| Synonyms | Source |
|---|---|
| 3beta,7alpha-Dihydroxy-5-androstene-17-one | KEGG COMPOUND |
| (3β,7α)-3,7-dihydroxyandrost-5-en-17-one | IUPAC |
| 7alpha-Hydroxydehydroepiandrosterone | ChemIDplus |
| 7alpha-Hydroxy-DHEA | ChemIDplus |
| 7alpha-OH-DHEA | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3β,7α-dihydroxyandrost-5-en-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7alpha-Hydroxy-DHEA | Wikipedia |
| C18045 | KEGG COMPOUND |
| HMDB0004611 | HMDB |
| LMST02020101 | LIPID MAPS |
| US2003216588 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2625222 | Reaxys |
| CAS:53-00-9 | KEGG COMPOUND |
| CAS:53-00-9 | ChemIDplus |
| Citations |
|---|