EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O3 |
| Net Charge | 0 |
| Average Mass | 332.484 |
| Monoisotopic Mass | 332.23514 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])C(=O)CO)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C21H32O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h13,15-18,22H,3-12H2,1-2H3/t13-,15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | USPYDUPOCUYHQL-KVHKMPIWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) has functional parent 11-deoxycorticosterone (CHEBI:16973) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) has parent hydride 5α-pregnane (CHEBI:20656) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) has role anticonvulsant (CHEBI:35623) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) has role GABA modulator (CHEBI:50268) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) has role progesterone receptor agonist (CHEBI:70709) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) is a 20-oxo steroid (CHEBI:36885) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) is a 21-hydroxy steroid (CHEBI:35344) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) is a 3-oxo-5α-steroid (CHEBI:13601) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) is a mineralocorticoid (CHEBI:25354) |
| 5α-dihydrodeoxycorticosterone (CHEBI:81468) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 21-hydroxy-5α-pregnane-3,20-dione |
| Synonyms | Source |
|---|---|
| (5α)-21-hydroxypregnane-3,20-dione | ChEBI |
| 5α-dihydro-11-deoxycorticosterone | ChemIDplus |
| 5α-pregnan-21-ol-3,20-dione | KEGG COMPOUND |
| allopregnane-21-ol-3,20-dione | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 5α-dihydrodeoxycorticosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4953958 | ChemSpider |
| C18040 | KEGG COMPOUND |
| Dihydrodeoxycorticosterone | Wikipedia |
| HMDB0060407 | HMDB |
| LMST02030134 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:298-36-2 | ChemIDplus |
| Citations |
|---|