EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O3 |
| Net Charge | 0 |
| Average Mass | 332.484 |
| Monoisotopic Mass | 332.23514 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C(C)=O)CC[C@@]3([H])[C@]1([H])[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C21H32O3/c1-12(22)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(23)10-13(20)11-18(19)24/h11,14-19,23-24H,4-10H2,1-3H3/t14-,15+,16-,17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | UEWNVBNIVGLQPG-XXHSLLPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coturnix japonica (ncbitaxon:93934) | - | PubMed (19362555) | |
| Cynops pyrrhogaster (ncbitaxon:8330) | - | PubMed (19456338) | |
| Ictalurus punctatus (ncbitaxon:7998) | - | PubMed (9679086) | |
| Oncorhynchus mykiss (ncbitaxon:8022) | - | PubMed (12714005) | |
| Petromyzon marinus (ncbitaxon:7757) | - | PubMed (15193266) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α-hydroxypregnenolone (CHEBI:81467) has functional parent pregnenolone (CHEBI:16581) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role dopaminergic agent (CHEBI:48560) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role marine metabolite (CHEBI:76507) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role nootropic agent (CHEBI:66980) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role rat metabolite (CHEBI:86264) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 20-oxo steroid (CHEBI:36885) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 7α-hydroxy steroid (CHEBI:36843) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a C21-steroid (CHEBI:61313) |
| IUPAC Name |
|---|
| 3β,7α-dihydroxypregn-5-en-20-one |
| Synonyms | Source |
|---|---|
| 3beta,7alpha-Dihydroxy-5-pregnen-20-one | KEGG COMPOUND |
| (3β,7α)-3,7-dihydroxypregn-5-en-20-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 7α-hydroxypregnenolone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18038 | KEGG COMPOUND |
| HMDB0060424 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3157694 | Reaxys |
| Citations |
|---|