EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O3 |
| Net Charge | 0 |
| Average Mass | 332.484 |
| Monoisotopic Mass | 332.23514 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C(C)=O)CC[C@@]3([H])[C@]1([H])[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C21H32O3/c1-12(22)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(23)10-13(20)11-18(19)24/h11,14-19,23-24H,4-10H2,1-3H3/t14-,15+,16-,17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | UEWNVBNIVGLQPG-XXHSLLPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coturnix japonica (ncbitaxon:93934) | - | PubMed (19362555) | |
| Cynops pyrrhogaster (ncbitaxon:8330) | - | PubMed (19456338) | |
| Ictalurus punctatus (ncbitaxon:7998) | - | PubMed (9679086) | |
| Oncorhynchus mykiss (ncbitaxon:8022) | - | PubMed (12714005) | |
| Petromyzon marinus (ncbitaxon:7757) | - | PubMed (15193266) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α-hydroxypregnenolone (CHEBI:81467) has functional parent pregnenolone (CHEBI:16581) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role dopaminergic agent (CHEBI:48560) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role marine metabolite (CHEBI:76507) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role nootropic agent (CHEBI:66980) |
| 7α-hydroxypregnenolone (CHEBI:81467) has role rat metabolite (CHEBI:86264) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 20-oxo steroid (CHEBI:36885) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a 7α-hydroxy steroid (CHEBI:36843) |
| 7α-hydroxypregnenolone (CHEBI:81467) is a C21-steroid (CHEBI:61313) |
| IUPAC Name |
|---|
| 3β,7α-dihydroxypregn-5-en-20-one |
| Synonyms | Source |
|---|---|
| 3beta,7alpha-Dihydroxy-5-pregnen-20-one | KEGG COMPOUND |
| (3β,7α)-3,7-dihydroxypregn-5-en-20-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 7α-hydroxypregnenolone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18038 | KEGG COMPOUND |
| HMDB0060424 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3157694 | Reaxys |
| Citations |
|---|