EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81466 - 5-deoxystrigol
| Formula | C19H22O5 |
| Net Charge | 0 |
| Average Mass | 330.380 |
| Monoisotopic Mass | 330.14672 |
| SMILES | [H][C@]12OC(=O)/C(=C/O[C@H]3C=C(C)C(=O)O3)[C@@]1([H])CC1=C2C(C)(C)CCC1 |
| InChI | InChI=1S/C19H22O5/c1-10-7-14(23-17(10)20)22-9-13-12-8-11-5-4-6-19(2,3)15(11)16(12)24-18(13)21/h7,9,12,14,16H,4-6,8H2,1-3H3/b13-9+/t12-,14-,16+/m1/s1 |
| InChIKey | QXTUQXRFEBHUBA-DYLOANJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lotus japonicus (ncbitaxon:34305) | Root (BTO:0001188) | PubMed (17655890) | |
| Solanum lycopersicum (ncbitaxon:4081) | Root (BTO:0001188) | PubMed (30280444) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-deoxystrigol (CHEBI:81466) has functional parent 5-deoxystrigol ABC-rings (CHEBI:81465) |
| 5-deoxystrigol (CHEBI:81466) has role plant metabolite (CHEBI:76924) |
| 5-deoxystrigol (CHEBI:81466) is a indenofuran (CHEBI:149453) |
| 5-deoxystrigol (CHEBI:81466) is a strigolactone (CHEBI:68487) |
| IUPAC Name |
|---|
| (3E,3aR,8bS)-8,8-dimethyl-3-({[(2R)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylidene)-3,3a,4,5,6,7,8,8b-octahydro-2H-indeno[1,2-b]furan-2-one |
| Synonym | Source |
|---|---|
| (+)-5-deoxystrigol | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-deoxystrigol | UniProt |
| Citations |
|---|