EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8146 - 2-hydroxy-3-phosphonooxybut-3-enoic acid
| Formula | C4H7O7P |
| Net Charge | 0 |
| Average Mass | 198.067 |
| Monoisotopic Mass | 197.99294 |
| SMILES | C=C(OP(=O)(O)O)C(O)C(=O)O |
| InChI | InChI=1S/C4H7O7P/c1-2(3(5)4(6)7)11-12(8,9)10/h3,5H,1H2,(H,6,7)(H2,8,9,10) |
| InChIKey | FPQJGWWGSNGINK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-phosphonooxybut-3-enoic acid (CHEBI:8146) is a carboxyalkyl phosphate (CHEBI:36952) |
| Synonyms | Source |
|---|---|
| Phosphoenol-4-deoxy-3-tetrulosonate | KEGG COMPOUND |
| phosphoenol-4-deoxy-3-tetrulosonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04309 | KEGG COMPOUND |