EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N3O9 |
| Net Charge | 0 |
| Average Mass | 379.366 |
| Monoisotopic Mass | 379.15908 |
| SMILES | C[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]2O)[C@@H](N)C[C@@H]1NC(=N)C(=O)O |
| InChI | InChI=1S/C14H25N3O9/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24)/t3-,4+,5+,6-,7+,8+,9-,10+,11+,14-/m1/s1 |
| InChIKey | PVTHJAPFENJVNC-MHRBZPPQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces kasugaensis (ncbitaxon:1946) | - | PubMed (16998486) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kasugamycin (CHEBI:81419) has role antifungal agrochemical (CHEBI:86328) |
| kasugamycin (CHEBI:81419) has role bacterial metabolite (CHEBI:76969) |
| kasugamycin (CHEBI:81419) has role protein synthesis inhibitor (CHEBI:48001) |
| kasugamycin (CHEBI:81419) is a amino cyclitol glycoside (CHEBI:22479) |
| kasugamycin (CHEBI:81419) is a aminoglycoside antibiotic (CHEBI:22507) |
| kasugamycin (CHEBI:81419) is a antibiotic fungicide (CHEBI:87114) |
| kasugamycin (CHEBI:81419) is a carboxamidine (CHEBI:35359) |
| kasugamycin (CHEBI:81419) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (1S,2R,3S,4R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl 2-amino-4-{[carboxy(imino)methyl]amino}-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranoside |
| Synonyms | Source |
|---|---|
| Kasumin L | KNApSAcK |
| Kasumin 2L | KNApSAcK |
| 3-O-[2-amino-4-[(carboxyiminomethyl)amino]-2,3,4,6-tetradeoxy-α-D-arabino-hexopyranosyl]-D-chiro-inositol | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C17968 | KEGG COMPOUND |
| KSG | PDBeChem |
| C00018722 | KNApSAcK |
| Kasugamycin | Wikipedia |
| kasugamycin | Alan Wood's Pesticides |
| 2195 | PPDB |
| 2195 | BPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1403823 | Reaxys |
| CAS:6980-18-3 | KEGG COMPOUND |
| CAS:6980-18-3 | ChemIDplus |
| Citations |
|---|