EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10NO4P |
| Net Charge | 0 |
| Average Mass | 167.101 |
| Monoisotopic Mass | 167.03474 |
| SMILES | N[C@@H](CC[PH](=O)O)C(=O)O |
| InChI | InChI=1S/C4H10NO4P/c5-3(4(6)7)1-2-10(8)9/h3,10H,1-2,5H2,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | IDBRULKICVRMNG-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Demethylphosphinothricin (CHEBI:81414) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| (2S)-2-Amino-4-(hydroxyphosphinyl)butanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17962 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:85178-62-7 | KEGG COMPOUND |