EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O5P |
| Net Charge | 0 |
| Average Mass | 166.069 |
| Monoisotopic Mass | 166.00311 |
| SMILES | O=C(O)C(=O)CC[PH](=O)O |
| InChI | InChI=1S/C4H7O5P/c5-3(4(6)7)1-2-10(8)9/h10H,1-2H2,(H,6,7)(H,8,9) |
| InChIKey | KCKUCNHSUALTMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deamino-alpha-keto-demethylphosphinothricin (CHEBI:81404) is a oxo carboxylic acid (CHEBI:25754) |
| Synonym | Source |
|---|---|
| 4-(Hydroxyphosphinyl)-2-oxobutyric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17948 | KEGG COMPOUND |