EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O5 |
| Net Charge | 0 |
| Average Mass | 364.357 |
| Monoisotopic Mass | 364.10592 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C20H16N2O5/c1-2-20(26)14-7-16-17-11(5-10-6-12(23)3-4-15(10)21-17)8-22(16)18(24)13(14)9-27-19(20)25/h3-7,23,26H,2,8-9H2,1H3/t20-/m0/s1 |
| InChIKey | HAWSQZCWOQZXHI-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-Hydroxycamptothecin (CHEBI:81395) has role antineoplastic agent (CHEBI:35610) |
| 10-Hydroxycamptothecin (CHEBI:81395) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonyms | Source |
|---|---|
| 10-hcpt | ChEMBL |
| 10-hydroxy camptothecin | ChEMBL |
| 10-hydroxy-camptothecin | ChEMBL |
| 10-hydroxycamptothecin | ChEMBL |
| 10-hydroxycamptothecine | ChEMBL |
| hydroxycamptothecin | ChEMBL |
| Citations |
|---|