EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | CC(N)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3 |
| InChIKey | GEFQWZLICWMTKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nordephrine (CHEBI:81386) is a catecholamine (CHEBI:33567) |
| Synonyms | Source |
|---|---|
| alpha-Methylnoradrenaline | KEGG COMPOUND |
| alpha-Methylnorepinephrine | KEGG COMPOUND |
| cobefrin | DrugCentral |
| nordefrin HCl | DrugCentral |
| nordefrin hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3203 | DrugCentral |
| C17925 | KEGG COMPOUND |
| HMDB0002832 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:6539-57-7 | KEGG COMPOUND |
| CAS:74812-63-8 | DrugCentral |