EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@@H](O)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12,14,16H,1,5-7,9H2,2-4H3/t11-,12-,14+,15+/m1/s1 |
| InChIKey | GFNWRKNVTHDNPV-UXOAXIEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia oxyphylla (ncbitaxon:125261) | fruit (BTO:0000486) | PubMed (23711917) | |
| Callitropsis nootkatensis (ncbitaxon:85954) | - | PubMed (21654582) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-nootkatol (CHEBI:81378) has role plant metabolite (CHEBI:76924) |
| β-nootkatol (CHEBI:81378) is a 6-isopropenyl-4,4a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol (CHEBI:142044) |
| IUPAC Name |
|---|
| (2S,4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 2α-hydroxyvalencene | ChEBI |
| 2α-hydroxy-4α,5α,7β-eremophil-1(10),11-diene | ChEBI |
| 4α,4aα-dimethyl-6β-(1-methylethenyl)-2,3,4,4a,5,6,7,8-octahydronaphthalene-2α-ol | ChEBI |
| β-nootkatol | ChemIDplus |
| (+)-trans-nootkatol | ChEBI |
| trans-nootkatol | ChEBI |
| UniProt Name | Source |
|---|---|
| nootkatol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C17915 | KEGG COMPOUND |
| HMDB0013688 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212839 | Reaxys |
| CAS:50763-67-2 | KEGG COMPOUND |
| CAS:50763-67-2 | ChemIDplus |
| Citations |
|---|