EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O |
| Net Charge | 0 |
| Average Mass | 218.340 |
| Monoisotopic Mass | 218.16707 |
| SMILES | C=C(C)[C@@H]1CCC2=CC(=O)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12H,1,5-7,9H2,2-4H3/t11-,12-,15+/m1/s1 |
| InChIKey | WTOYNNBCKUYIKC-JMSVASOKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callitropsis nootkatensis (ncbitaxon:85954) | - | PubMed (15962787) | |
| Citrus x paradisi (ncbitaxon:37656) | - | PubMed (16272746) | |
| Cyperus rotundus (ncbitaxon:512623) | - | PubMed (24704449) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-nootkatone (CHEBI:81377) has role fragrance (CHEBI:48318) |
| (+)-nootkatone (CHEBI:81377) has role insect repellent (CHEBI:71692) |
| (+)-nootkatone (CHEBI:81377) has role plant metabolite (CHEBI:76924) |
| (+)-nootkatone (CHEBI:81377) is a carbobicyclic compound (CHEBI:36785) |
| (+)-nootkatone (CHEBI:81377) is a enone (CHEBI:51689) |
| (+)-nootkatone (CHEBI:81377) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one |
| Synonym | Source |
|---|---|
| nootkatone | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-nootkatone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00016987 | KNApSAcK |
| C17914 | KEGG COMPOUND |
| HMDB0013687 | HMDB |
| Nootkatone | Wikipedia |
| US2012045806 | Patent |
| Citations |
|---|