EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO |
| Net Charge | 0 |
| Average Mass | 179.263 |
| Monoisotopic Mass | 179.13101 |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3/t9-,11+/m0/s1 |
| InChIKey | FMCGSUUBYTWNDP-GXSJLCMTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-N-methylpseudoephedrine (CHEBI:81373) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| C17903 | KEGG COMPOUND |