EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO4 |
| Net Charge | 0 |
| Average Mass | 329.396 |
| Monoisotopic Mass | 329.16271 |
| SMILES | [H][C@]12CC(=O)C(OC)=C[C@]13CCN(C)[C@H]2Cc1ccc(OC)c(O)c13 |
| InChI | InChI=1S/C19H23NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,10,12-13,22H,6-9H2,1-3H3/t12-,13+,19-/m1/s1 |
| InChIKey | OWDQPILTDJLGCN-QHRIQVFBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isosinomenine (CHEBI:81369) is a morphinane alkaloid (CHEBI:25418) |
| Manual Xrefs | Databases |
|---|---|
| C17899 | KEGG COMPOUND |