EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O3 |
| Net Charge | 0 |
| Average Mass | 192.214 |
| Monoisotopic Mass | 192.07864 |
| SMILES | COc1cc(/C=C/C(C)=O)ccc1O |
| InChI | InChI=1S/C11H12O3/c1-8(12)3-4-9-5-6-10(13)11(7-9)14-2/h3-7,13H,1-2H3/b4-3+ |
| InChIKey | AFWKBSMFXWNGRE-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dehydrozingerone (CHEBI:81361) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| C17840 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1080-12-2 | KEGG COMPOUND |