EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O15 |
| Net Charge | 0 |
| Average Mass | 608.549 |
| Monoisotopic Mass | 608.17412 |
| SMILES | COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H32O15/c1-39-14-7-15-18(12(32)6-13(40-15)10-2-4-11(31)5-3-10)22(35)19(14)26-27(24(37)21(34)16(8-29)41-26)43-28-25(38)23(36)20(33)17(9-30)42-28/h2-7,16-17,20-21,23-31,33-38H,8-9H2,1H3/t16-,17-,20-,21-,23+,24+,25-,26+,27-,28+/m1/s1 |
| InChIKey | VGGSULWDCMWZPO-ODEMIOGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus jujuba var. spinosa (ncbitaxon:714518) | - | PubMed (25767684) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spinosin (CHEBI:81360) has functional parent flavone (CHEBI:42491) |
| spinosin (CHEBI:81360) has role anxiolytic drug (CHEBI:35474) |
| spinosin (CHEBI:81360) has role plant metabolite (CHEBI:76924) |
| spinosin (CHEBI:81360) is a dihydroxyflavone (CHEBI:38686) |
| spinosin (CHEBI:81360) is a flavone C-glycoside (CHEBI:83280) |
| spinosin (CHEBI:81360) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-β-D-glucopyranosyl-1-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-1-benzopyran-6-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 2''-O-glycosylswertisin | ChEBI |
| 6-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| flavoayamenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00006268 | KNApSAcK |
| C17834 | KEGG COMPOUND |
| LMPK12110988 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6837776 | Reaxys |
| CAS:72063-39-9 | KEGG COMPOUND |
| CAS:72063-39-9 | ChemIDplus |
| Citations |
|---|