EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O6 |
| Net Charge | 0 |
| Average Mass | 374.433 |
| Monoisotopic Mass | 374.17294 |
| SMILES | COc1cc(CCC(=O)CC(O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H26O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,16,22,24-25H,3-4,7-8,13H2,1-2H3 |
| InChIKey | RSAHICAPUYTWHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexahydrocurcumin (CHEBI:81358) is a diarylheptanoid (CHEBI:78802) |
| Manual Xrefs | Databases |
|---|---|
| C17826 | KEGG COMPOUND |